949159-96-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H14F3N.
The molecular weight of the compound is 265.27 g/mol.
The IUPAC name of the compound is 2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]aniline.
The InChI code of the compound is InChI=1S/C15H14F3N/c1-10-6-7-11(2)14(8-10)19-13-5-3-4-12(9-13)15(16,17)18/h3-9,19H,1-2H3.
The InChIKey of the compound is SWUBPLNGYDBIAV-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CC(=C(C=C1)C)NC2=CC=CC(=C2)C(F)(F)F.
The XLogP3-AA value of the compound is 5.1.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 12.2 ?2.