N-Tetradecanophenone

CAS

948663

Catalog Number

ACM948663-1

Category

Other Products

Molecular Formula

C₂₀H₃₂O

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of N-Tetradecanophenone?

The molecular formula of N-Tetradecanophenone is C20H32O.

What are some synonyms for N-Tetradecanophenone?

Some synonyms for N-Tetradecanophenone are Tetradecanophenone, Myristophenone, and Tridecyl phenyl ketone.

What is the molecular weight of N-Tetradecanophenone?

The molecular weight of N-Tetradecanophenone is 288.5 g/mol.

When was N-Tetradecanophenone created and last modified?

N-Tetradecanophenone was created on March 26, 2005, and last modified on December 30, 2023.

What is the IUPAC name of N-Tetradecanophenone?

The IUPAC name of N-Tetradecanophenone is 1-phenyltetradecan-1-one.

What is the InChI of N-Tetradecanophenone?

The InChI of N-Tetradecanophenone is InChI=1S/C20H32O/c1-2-3-4-5-6-7-8-9-10-11-15-18-20(21)19-16-13-12-14-17-19/h12-14,16-17H,2-11,15,18H2,1H3.

What is the InChIKey of N-Tetradecanophenone?

The InChIKey of N-Tetradecanophenone is LXUIUVLDNRQBQJ-UHFFFAOYSA-N.

What is the canonical SMILES of N-Tetradecanophenone?

The canonical SMILES of N-Tetradecanophenone is CCCCCCCCCCCCCC(=O)C1=CC=CC=C1.

What are the other identifiers for N-Tetradecanophenone?

The other identifiers for N-Tetradecanophenone include CAS number 4497-05-6, European Community number 224-790-3, UNII 6Z2IU8420X, DSSTox Substance ID DTXSID0063496, Nikkaji Number J605J, NSC Number 18795, and Wikidata Q81990778.

What are some computed properties of N-Tetradecanophenone?

Some computed properties of N-Tetradecanophenone include its molecular weight (288.5 g/mol), XLogP3-AA (7.8), hydrogen bond donor count (0), hydrogen bond acceptor count (1), rotatable bond count (13), exact mass (288.245315640 g/mol), monoisotopic mass (288.245315640 g/mol), topological polar surface area (17.12), heavy atom count (21), formal charge (0), complexity (240), isotope atom count (0), defined atom stereocenter count (0), undefined atom stereocenter count (0), defined bond stereocenter count (0), undefined bond stereocenter count (0), covalently-bonded unit count (1), and compound is canonicalized (Yes).

Recommended Products