What is the molecular formula of 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester?
The molecular formula is C17H19NO4.
When was 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester created?
It was created on November 13, 2007.
What is the IUPAC Name of 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester?
The IUPAC Name is diethyl 6,7-dimethylquinoline-2,3-dicarboxylate.
What is the InChI of 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester?
The InChI is InChI=1S/C17H19NO4/c1-5-21-16(19)13-9-12-7-10(3)11(4)8-14(12)18-15(13)17(20)22-6-2/h7-9H,5-6H2,1-4H3.
What is the Canonical SMILES of 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester?
The Canonical SMILES is CCOC(=O)C1=C(N=C2C=C(C(=CC2=C1)C)C)C(=O)OCC.
How many Hydrogen Bond Acceptor Count does 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester have?
It has 5 Hydrogen Bond Acceptor Count.
What is the Exact Mass of 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester?
The Exact Mass is 301.13140809 g/mol.
What is the Topological Polar Surface Area of 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester?
The Topological Polar Surface Area is 65.5 Ų.
How many Heavy Atoms does 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester have?
It has 22 Heavy Atoms.
Is 6,7-Dimethylquinoline-2,3-dicarboxylic acid diethyl ester a Covalently-Bonded Unit?
Yes, it is a Covalently-Bonded Unit.