What is the molecular formula of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The molecular formula is C12H11Cl2N.
What is the molecular weight of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The molecular weight is 240.12 g/mol.
What is the IUPAC name of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The IUPAC name is 2-chloro-3-(chloromethyl)-7-ethylquinoline.
What is the InChI of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The InChI is InChI=1S/C12H11Cl2N/c1-2-8-3-4-9-6-10(7-13)12(14)15-11(9)5-8/h3-6H,2,7H2,1H3.
What is the InChIKey of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The InChIKey is COXZWIUTJQZOIH-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The Canonical SMILES is CCC1=CC2=NC(=C(C=C2C=C1)CCl)Cl.
What is the XLogP3-AA value of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The XLogP3-AA value is 4.3.
How many hydrogen bond donor counts are there in 2-Chloro-3-chloromethyl-7-ethylquinoline?
There are 0 hydrogen bond donor counts.
What is the topological polar surface area of 2-Chloro-3-chloromethyl-7-ethylquinoline?
The topological polar surface area is 12.9 Ų.
Is 2-Chloro-3-chloromethyl-7-ethylquinoline a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.