94805-51-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H11N3O.
The molecular weight of the compound is 189.21 g/mol.
The IUPAC name of the compound is 2,4,6-trimethylpyrazolo[1,5-a]pyrazine-3-carbaldehyde.
The InChI of the compound is InChI=1S/C10H11N3O/c1-6-4-13-10(8(3)11-6)9(5-14)7(2)12-13/h4-5H,1-3H3.
The InChIKey of the compound is DVNMXDVEXBXNJR-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CN2C(=C(C(=N2)C)C=O)C(=N1)C.
The CAS number of the compound is 94813-92-0.
The DSSTox Substance ID of the compound is DTXSID00668341.
The XLogP3-AA value of the compound is 0.7.
Yes, the compound is canonicalized.