947533-84-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H12BrN3.
The molecular weight of the compound is 266.14 g/mol.
The IUPAC name of the compound is 6-bromo-2-cyclopentyl-1H-imidazo[4,5-b]pyridine.
The InChI of the compound is InChI=1S/C11H12BrN3/c12-8-5-9-11(13-6-8)15-10(14-9)7-3-1-2-4-7/h5-7H,1-4H2,(H,13,14,15).
The InChIKey of the compound is ZGWSYJPCKHPBPY-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CCC(C1)C2=NC3=C(N2)C=C(C=N3)Br.
The CAS number of the compound is 947533-90-6.
The hydrogen bond donor count of the compound is 1.
The hydrogen bond acceptor count of the compound is 2.
Yes, the compound is canonicalized.