946784-67-4 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C8H8F2N2O.
The IUPAC name of the compound is N-(3-amino-2,6-difluorophenyl)acetamide.
The InChI of the compound is InChI=1S/C8H8F2N2O/c1-4(13)12-8-5(9)2-3-6(11)7(8)10/h2-3H,11H2,1H3,(H,12,13).
The InChIKey of the compound is ZVNQJJLMTSCQSO-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(=O)NC1=C(C=CC(=C1F)N)F.
The molecular weight of the compound is 186.16 g/mol.
The XLogP3-AA value of the compound is 0.6.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.