What is the molecular formula of 2-(Benzylamino)pyrimidine-5-carbaldehyde?
The molecular formula is C12H11N3O.
What is the molecular weight of 2-(Benzylamino)pyrimidine-5-carbaldehyde?
The molecular weight is 213.23 g/mol.
What is the IUPAC name of 2-(Benzylamino)pyrimidine-5-carbaldehyde?
The IUPAC name is 2-(benzylamino)pyrimidine-5-carbaldehyde.
What is the InChI of 2-(Benzylamino)pyrimidine-5-carbaldehyde?
The InChI is InChI=1S/C12H11N3O/c16-9-11-7-14-12(15-8-11)13-6-10-4-2-1-3-5-10/h1-5,7-9H,6H2,(H,13,14,15).
What is the InChIKey of 2-(Benzylamino)pyrimidine-5-carbaldehyde?
The InChIKey is LYCVAJMGIHAWPH-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-(Benzylamino)pyrimidine-5-carbaldehyde?
The Canonical SMILES is C1=CC=C(C=C1)CNC2=NC=C(C=N2)C=O.
How many hydrogen bond donor counts does 2-(Benzylamino)pyrimidine-5-carbaldehyde have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-(Benzylamino)pyrimidine-5-carbaldehyde have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-(Benzylamino)pyrimidine-5-carbaldehyde?
The topological polar surface area is 54.9 Ų.
Is 2-(Benzylamino)pyrimidine-5-carbaldehyde a canonicalized compound?
Yes, it is a canonicalized compound.