946760-07-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H14N2O3.
The molecular weight of the compound is 222.24 g/mol.
Some synonyms for the compound are 3-(3-METHYL-4-NITROPHENOXY)PYRROLIDINE, 946760-47-0, and AKOS011612171.
The InChIKey of the compound is PRIBNNSMGXTXTJ-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC1=C(C=CC(=C1)OC2CCNC2)[N+](=O)[O-].
The compound has 1 hydrogen bond donor count.
The exact mass of the compound is 222.10044231 g/mol.
The compound has 4 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 67.1 Ų.
Yes, the compound is canonicalized.