CAS
946726-75-6 Purity
---
946726-75-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C10H11F2NO.
The molecular weight is 199.20 g/mol.
The IUPAC name is 3-(3,4-difluorophenoxy)pyrrolidine.
The Canonical SMILES is C1CNCC1OC2=CC(=C(C=C2)F)F.
There is 1 hydrogen bond donor count.
There are 4 hydrogen bond acceptor counts.
The XLogP3-AA value is 1.9.
The exact mass is 199.08087030 g/mol.
The topological polar surface area is 21.3 Å2.
Yes, the compound is canonicalized.