What is the molecular formula of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The molecular formula is C16H22ClNO2.
What is the molecular weight of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The molecular weight is 295.80 g/mol.
What is the IUPAC name of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The IUPAC name is tert-butyl 4-(4-chlorophenyl)piperidine-1-carboxylate.
What is the InChI of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The InChI is InChI=1S/C16H22ClNO2/c1-16(2,3)20-15(19)18-10-8-13(9-11-18)12-4-6-14(17)7-5-12/h4-7,13H,8-11H2,1-3H3.
What is the InChIKey of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The InChIKey is ODNDRHCDSBWGGD-UHFFFAOYSA-N.
What is the canonical SMILES of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The canonical SMILES is CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=C(C=C2)Cl.
What is the CAS number of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The CAS number is 946593-11-9.
What is the formal charge of tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate?
The formal charge is 0.
How many hydrogen bond acceptor counts does tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate have?
It has 2 hydrogen bond acceptor counts.
Is tert-Butyl 4-(4-chlorophenyl)piperidine-1-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound.