Amoxicillin diketopiperazine

CAS

94659-47-9

Catalog Number

ACM94659479

Category

Other Products

Molecular Weight

365.40

Molecular Formula

C₁₆H₁₉N₃O₅S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

2-[5-(4-Hydroxyphenyl)-3,6-dioxo-2-piperazinyl]-5,5-dimethyl-4-thiazolidinecarboxylic Acid; 2,5-Amoxipiperazinedione; Amoxicillin Piperazine-2,5-dione;

Appearance

Pale Yellow Solid

What is the molecular formula of Amoxicillin diketopiperazine?

The molecular formula of Amoxicillin diketopiperazine is C16H19N3O5S.

What are the synonyms for Amoxicillin diketopiperazine?

The synonyms for Amoxicillin diketopiperazine include 94659-47-9, Amoxicillin Diketopiperazine, 2-[5-(4-hydroxyphenyl)-3,6-dioxopiperazin-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid, and Amoxicillin Impurity C.

What is the molecular weight of Amoxicillin diketopiperazine?

The molecular weight of Amoxicillin diketopiperazine is 365.4 g/mol.

What is the IUPAC name of Amoxicillin diketopiperazine?

The IUPAC name of Amoxicillin diketopiperazine is 2-[5-(4-hydroxyphenyl)-3,6-dioxopiperazin-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid.

What is the InChI of Amoxicillin diketopiperazine?

The InChI of Amoxicillin diketopiperazine is InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-14(25-16)10-13(22)17-9(12(21)18-10)7-3-5-8(20)6-4-7/h3-6,9-11,14,19-20H,1-2H3,(H,17,22)(H,18,21)(H,23,24).

What is the InChIKey of Amoxicillin diketopiperazine?

The InChIKey of Amoxicillin diketopiperazine is IIZCCQJEPBWGJU-UHFFFAOYSA-N.

What is the Canonical SMILES of Amoxicillin diketopiperazine?

The Canonical SMILES of Amoxicillin diketopiperazine is CC1(C(NC(S1)C2C(=O)NC(C(=O)N2)C3=CC=C(C=C3)O)C(=O)O).

What is the CAS number of Amoxicillin diketopiperazine?

The CAS number of Amoxicillin diketopiperazine is 94659-47-9.

What is the XLogP3-AA value of Amoxicillin diketopiperazine?

The XLogP3-AA value of Amoxicillin diketopiperazine is -1.8.

Is Amoxicillin diketopiperazine defined as a canonicalized compound?

Yes, Amoxicillin diketopiperazine is considered as a canonicalized compound.

Recommended Products