What is the molecular formula of Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride?
The molecular formula is C10H16ClNO3.
When was Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride created?
It was created on 2005-08-08.
What is the IUPAC name of Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride?
The IUPAC name is [1-(3,4-dihydroxyphenyl)-1-hydroxypropan-2-yl]-methylazanium;chloride.
What is the InChIKey of Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride?
The InChIKey is HPDZIFBLRDLGFA-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride?
The canonical SMILES is CC(C(C1=CC(=C(C=C1)O)O)O)[NH2+]C.[Cl-].
What is the molecular weight of Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride?
The molecular weight is 233.69 g/mol.
How many hydrogen bond donor count does Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride have?
It has 4 hydrogen bond donors.
What is the exact mass of Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride?
The exact mass is 233.0818711 g/mol.
How many heavy atoms are present in Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride?
There are 15 heavy atoms present.
Is Methyl(beta,3,4-trihydroxy-alpha-methylphenethyl)ammonium chloride a canonicalized compound?
Yes, it is canonicalized.