Methanone,[2-(dimethylamino)-7-hydroxy-6-methoxy-3-benzofuranyl](3,4,5-trimethoxyphenyl)-

CAS

945771-84-6

Catalog Number

ACM945771846

Category

Other Products

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the PubChem CID of the compound?

The PubChem CID of the compound is 45119655.

What is the molecular formula of the compound?

The molecular formula of the compound is C21H23NO7.

What are the synonyms for the compound?

The synonyms for the compound are 945771-84-6, SCHEMBL9906592, and METHANONE,[2-(DIMETHYLAMINO)-7-HYDROXY-6-METHOXY-3-BENZOFURANYL](3,4,5-TRIMETHOXYPHENYL)-.

What is the molecular weight of the compound?

The molecular weight of the compound is 401.4 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [2-(dimethylamino)-7-hydroxy-6-methoxy-1-benzofuran-3-yl]-(3,4,5-trimethoxyphenyl)methanone.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C21H23NO7/c1-22(2)21-16(12-7-8-13(25-3)18(24)19(12)29-21)17(23)11-9-14(26-4)20(28-6)15(10-11)27-5/h7-10,24H,1-6H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IEIWVWDHXMYFLB-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CN(C)C1=C(C2=C(O1)C(=C(C=C2)OC)O)C(=O)C3=CC(=C(C(=C3)OC)OC)OC.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.7.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 1.

Recommended Products