What is the molecular formula of 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester?
The molecular formula is C8H5F3N2O3S.
What is the molecular weight of 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester?
The molecular weight is 266.20 g/mol.
What is the IUPAC name of 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester?
The IUPAC name is 1H-indazol-7-yl trifluoromethanesulfonate.
What is the Canonical SMILES representation of 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester?
The Canonical SMILES representation is C1=CC2=C(C(=C1)OS(=O)(=O)C(F)(F)F)NN=C2.
What is the InChIKey of 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester?
The InChIKey is NMNSIXPNRMMDKQ-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester have?
It has 7 hydrogen bond acceptor counts.
What is the topological polar surface area of 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester?
The topological polar surface area is 80.4 Ų.
Does 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester have any defined atom stereocenter counts?
It does not have any defined atom stereocenter counts.
Is 1,1,1-Trifluoro-methanesulfonic acid 1H-indazol-7-yl ester a canonicalized compound?
Yes, it is a canonicalized compound.