944905-47-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C6H4ClF3N2.
The IUPAC name of the compound is 2-(chloromethyl)-4-(trifluoromethyl)pyrimidine.
The molecular weight of the compound is 196.56 g/mol.
The InChI of the compound is InChI=1S/C6H4ClF3N2/c7-3-5-11-2-1-4(12-5)6(8,9)10/h1-2H,3H2.
The InChIKey of the compound is CEVIJOALFRBIOW-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CN=C(N=C1C(F)(F)F)CCl.
The CAS number of the compound is 944905-91-3.
The EC number of the compound is 859-583-2.
The hydrogen bond donor count of the compound is 0.
Yes, the compound is canonicalized.