944904-29-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H7BrN2O2.
Some synonyms of the compound are 2-(6-Bromo-1H-indazol-3-yl)acetic acid, 944904-66-9, (6-Bromo-1H-indazol-3-yl)acetic acid, and (6-BROMO-1H-INDAZOL-3-YL)-ACETIC ACID.
The molecular weight of the compound is 255.07 g/mol.
The IUPAC name of the compound is 2-(6-bromo-2H-indazol-3-yl)acetic acid.
The InChI of the compound is InChI=1S/C9H7BrN2O2/c10-5-1-2-6-7(3-5)11-12-8(6)4-9(13)14/h1-3H,4H2,(H,11,12)(H,13,14).
The InChIKey of the compound is DSKLTNRDAAYQDC-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC2=C(NN=C2C=C1Br)CC(=O)O.
The CAS number of the compound is 944904-66-9.
Yes, the compound is canonicalized.