944899-60-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H5F3N2O2.
The molecular weight of the compound is 206.12 g/mol.
The IUPAC name of the compound is 5-amino-2-(trifluoromethyl)pyridine-4-carboxylic acid.
The InChI of the compound is InChI=1S/C7H5F3N2O2/c8-7(9,10)5-1-3(6(13)14)4(11)2-12-5/h1-2H,11H2,(H,13,14).
The InChIKey of the compound is UTORUAWKVSIHOQ-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1=C(C(=CN=C1C(F)(F)F)N)C(=O)O.
The CAS number of the compound is 944900-27-0.
The European Community (EC) number of the compound is 861-822-0.
The DSSTox Substance ID of the compound is DTXSID10697405.
Yes, the compound is canonicalized.