944834-42-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is N-[(2R,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-pentoxyoxan-3-yl]acetamide.
The InChI of the compound is InChI=1S/C13H25NO6/c1-3-4-5-6-19-13-10(14-8(2)16)12(18)11(17)9(7-15)20-13/h9-13,15,17-18H,3-7H2,1-2H3,(H,14,16)/t9-,10-,11-,12-,13-/m1/s1.
The InChIKey of the compound is TXAKGSVWAUXDOK-SYLRKERUSA-N.
The canonical SMILES of the compound is CCCCCOC1C(C(C(C(O1)CO)O)O)NC(=O)C.
The isomeric SMILES of the compound is CCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)NC(=O)C.
The molecular weight of the compound is 291.34 g/mol.
The XLogP3-AA value of the compound is -0.3.
The compound has 4 hydrogen bond donor counts.
The compound has 6 hydrogen bond acceptor counts.
The compound has 7 rotatable bond counts.