What is the molecular formula of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The molecular formula is C11H13ClNO3.
What are the synonyms for Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The synonyms are 94483-57-5 and CARBAMIC ACID,(3-CHLORO-4-METHOXYPHENYL)-, 1-METHYLETHYL ESTER (9CI).
What is the molecular weight of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The molecular weight is 242.68 g/mol.
What is the parent compound of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The parent compound is CID 53436722 ((3-Chloro-4-methoxyphenyl)-propan-2-ylcarbamic acid).
What is the IUPAC name of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The IUPAC name is N-(3-chloro-4-methoxyphenyl)-N-propan-2-ylcarbamate.
What is the InChI of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The InChI is InChI=1S/C11H14ClNO3/c1-7(2)13(11(14)15)8-4-5-10(16-3)9(12)6-8/h4-7H,1-3H3,(H,14,15)/p-1.
What is the InChIKey of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The InChIKey is SCENKZLFXJQGQP-UHFFFAOYSA-M.
What is the canonical SMILES of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The canonical SMILES is CC(C)N(C1=CC(=C(C=C1)OC)Cl)C(=O)[O-].
What is the XLogP3 value of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The XLogP3 value is 3.6.
What is the topological polar surface area of Carbamic acid,(3-chloro-4-methoxyphenyl)-,1-methylethyl ester(9ci)?
The topological polar surface area is 52.6 ?2.