CAS
944709-69-7 Purity
96%
944709-69-7 Purity
96%
Inquiry Basket
(2S,3S)-3-Amino-N-cyclopropyl-2-hydroxyhexanamide hydrochloride
CAS
944716-73-8
Catalog Number
ACM944716738
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H19ClN2O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 222.71 g/mol.
What are some synonyms for the compound?
Some synonyms for the compound are (2S,3S)-3-Amino-N-cyclopropyl-2-hydroxyhexanamide hydrochloride and (2S,3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide.
When was the compound created and last modified?
The compound was created on 2008-12-08 and last modified on 2023-12-30.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2S,3S)-3-amino-N-cyclopropyl-2-hydroxyhexanamide;hydrochloride.
What is the InChIKey of the compound?
The InChIKey of the compound is LMSDLVWKLIICSU-WSZWBAFRSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCCC(C(C(=O)NC1CC1)O)N.Cl.
What is the CAS number of the compound?
The CAS number of the compound is 944716-73-8.
What is the hydrogen bond donor count of the compound?
The compound has 4 hydrogen bond donor counts.
How many defined atom stereocenters does the compound have?
The compound has 2 defined atom stereocenters.
Recommended Products
![4-Chloro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid methyl ester](https://resource.alfa-chemistry.com/structure/944709-69-7.gif)
![Bis[2-(di-t-butylphosphino)ethyl]amine,min. 97%](https://resource.alfa-chemistry.com/structure/944710-34-3.gif)
CAS
944718-09-6 Purity
---
944718-09-6 Purity
---
![6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole](https://resource.alfa-chemistry.com/structure/944718-32-5.gif)
