944709-39-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H7BrN2O.
The molecular weight of the compound is 239.07 g/mol.
The IUPAC name of the compound is 3-(3-bromophenyl)-1H-imidazol-2-one.
The InChIKey of the compound is GSEFYTRZEWBZFT-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is C1=CC(=CC(=C1)Br)N2C=CNC2=O.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 32.3 Å^2.
The compound has 1 rotatable bond count.
Yes, the compound is considered canonicalized.
The XLogP3-AA value of the compound is 1.6.