2-Borono-6-ethoxy-1H-indole-1-carboxylic acid 1-(1,1-dimethylethyl)ester

CAS

944562-81-6

Catalog Number

ACM944562816

Category

Other Products

Molecular Formula

C₁₅H₂₀BNO₅

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

1H-Indole-1-carboxylic acid, 2-borono-6-ethoxy-, 1-(1,1-dimethylethyl) ester

What is the molecular formula of the compound?

The molecular formula of the compound is C15H20BNO5.

What is the synonyms of the compound?

The synonyms of the compound are 944562-81-6, 1H-Indole-1-carboxylic acid, 2-borono-6-ethoxy-, 1-(1,1-dimethylethyl) ester, 2-borono-6-ethoxy-1H-indole-1-carboxylic acid-1-(1,1-dimethylethyl) ester, 1H-Indole-1-carboxylic acid,2-borono-6-ethoxy-,1-(1,1-dimethylethyl) ester, SCHEMBL12996827.

What is the molecular weight of the compound?

The molecular weight of the compound is 305.14 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [6-ethoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C15H20BNO5/c1-5-21-11-7-6-10-8-13(16(19)20)17(12(10)9-11)14(18)22-15(2,3)4/h6-9,19-20H,5H2,1-4H3.

What is the InChIKey of the compound?

The InChIKey of the compound is BDJBXIOGZZPJNN-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)OCC)(O)O.

What is the CAS number of the compound?

The CAS number of the compound is 944562-81-6.