CAS
944-21-8 Purity
---
944-21-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C38H70O2.
The molecular weight is 559.0 g/mol.
[(E)-3,7,11,15-tetramethylhexadec-2-enyl] (9Z,12Z)-octadeca-9,12-dienoate.
CCCCCC=CCC=CCCCCCCCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C.
There are 29 rotatable bonds.
The XLogP3-AA value is 15.6.
There are 2 hydrogen bond acceptors.
The topological polar surface area is 26.3 Ų.
There are no defined atom stereocenters.
Yes, the compound is canonicalized.