CAS
944718-32-5 Purity
---
944718-32-5 Purity
---
![1H-Isoindole-1,3(2H)-dione,4-[2-(1,4-dihydro-2-hydroxy-1-methyl-4-oxo-3-quinolinyl)diazenyl]-2-[1-(methoxymethyl)propyl]-](https://resource.alfa-chemistry.com/structure/944747-11-9.gif)
Inquiry Basket
1H-Purine-2,6,8(3H)-trione,7,9-dihydro-1,3-dimethyl-
CAS
944-73-0
Catalog Number
ACM944730
Category
Other Products
Molecular Weight
196.16
Molecular Formula
C7H8N4O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1,3-dimethyluric acid?
The molecular formula of 1,3-dimethyluric acid is C7H8N4O3.
What is the molecular weight of 1,3-dimethyluric acid?
The molecular weight of 1,3-dimethyluric acid is 196.16 g/mol.
What is the IUPAC name of 1,3-dimethyluric acid?
The IUPAC name of 1,3-dimethyluric acid is 1,3-dimethyl-7,9-dihydropurine-2,6,8-trione.
What is the InChI key of 1,3-dimethyluric acid?
The InChI key of 1,3-dimethyluric acid is OTSBKHHWSQYEHK-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-dimethyluric acid?
The canonical SMILES of 1,3-dimethyluric acid is CN1C2=C(C(=O)N(C1=O)C)NC(=O)N2.
What is the CAS number of 1,3-dimethyluric acid?
The CAS number of 1,3-dimethyluric acid is 944-73-0.
What is the XLogP3 value of 1,3-dimethyluric acid?
The XLogP3 value of 1,3-dimethyluric acid is -0.5.
How many hydrogen bond donor counts does 1,3-dimethyluric acid have?
1,3-dimethyluric acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,3-dimethyluric acid have?
1,3-dimethyluric acid has 3 hydrogen bond acceptor counts.
Recommended Products
![6-Bromo-1-methyl-1H-benzo[d][1,2,3]triazole](https://resource.alfa-chemistry.com/structure/944718-32-5.gif)
![1H-Imidazo[4,5-e]tetrazolo[1,5-a]pyridine](https://resource.alfa-chemistry.com/structure/944721-60-2.gif)
