94349-45-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C20H18N2O4S.
The PubChem CID of the compound is 6366543.
The IUPAC name of the compound is 5-(4-butylphenoxy)sulfonyl-2-diazonionaphthalen-1-olate.
The InChI of the compound is InChI=1S/C20H18N2O4S/c1-2-3-5-14-8-10-15(11-9-14)26-27(24,25)19-7-4-6-17-16(19)12-13-18(22-21)20(17)23/h4,6-13H,2-3,5H2,1H3.
The InChIKey of the compound is IMVRRGAJJGEOEA-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCCCC1=CC=C(C=C1)OS(=O)(=O)C2=CC=CC3=C2C=CC(=C3[O-])[N+]#N.
The CAS number of the compound is 94349-48-1.
The molecular weight of the compound is 382.4 g/mol.
The compound has 0 hydrogen bond donor count.
The compound has 6 rotatable bond count.