What is the molecular formula of (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
The molecular formula is C52H98O5Sn2.
What are some synonyms for (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
Some synonyms include EINECS 305-143-5, 94349-26-5, and DTXSID701130055.
When was the PubChem CID created for (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
The PubChem CID was created on August 20, 2009.
What is the molecular weight of (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
The molecular weight is 1040.7 g/mol.
What is the Canonical SMILES representation of (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
The Canonical SMILES representation is CCCCCC=CCC=CCCCCCCCC(=O)O[Sn](CCCC)(CCCC)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCC=CCC=CCCCCC.
How many hydrogen bond donor counts are there in (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
There are 0 hydrogen bond donor counts.
What is the topological polar surface area of (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
The topological polar surface area is 61.8 Ų.
How many rotatable bond counts are there in (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
There are 46 rotatable bond counts.
What is the formal charge of (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
The formal charge is 0.
How many defined bond stereocenter counts are there in (9Z,12Z)-1,1,3,3-Tetrabutyl-1,3-bis(octadeca-9,12-dienoyloxy)distannoxane?
There are 4 defined bond stereocenter counts.