94333-42-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of Lithium hydrogen malate is C4H5LiO5.
The molecular weight of Lithium hydrogen malate is 140.0 g/mol.
Some synonyms for Lithium hydrogen malate include hydrogen malate lithium and EINECS 305-026-9.
The IUPAC name of Lithium hydrogen malate is lithium;3,4-dihydroxy-4-oxobutanoate.
The canonical SMILES for Lithium hydrogen malate is [Li+].C(C(C(=O)O)O)C(=O)[O-].
The InChIKey for Lithium hydrogen malate is DSNICULMAZJWBF-UHFFFAOYSA-M.
Lithium hydrogen malate has 2 hydrogen bond donor counts.
The exact mass of Lithium hydrogen malate is 140.02970169 g/mol.
No, Lithium hydrogen malate does not have any isotope atom count.
Yes, Lithium hydrogen malate is a canonicalized compound.