CAS
943153-51-3 Purity
---
943153-51-3 Purity
---
Inquiry Basket
1H-Imidazol-5-ylboronic acid
CAS
943186-65-6
Catalog Number
ACM943186656
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1H-Imidazol-5-ylboronic acid?
The molecular formula of 1H-Imidazol-5-ylboronic acid is C3H5BN2O2.
What is the PubChem CID of 1H-Imidazol-5-ylboronic acid?
The PubChem CID of 1H-Imidazol-5-ylboronic acid is 52988092.
What is the molecular weight of 1H-Imidazol-5-ylboronic acid?
The molecular weight of 1H-Imidazol-5-ylboronic acid is 111.90 g/mol.
What is the IUPAC name of 1H-Imidazol-5-ylboronic acid?
The IUPAC name of 1H-Imidazol-5-ylboronic acid is 1H-imidazol-5-ylboronic acid.
What is the InChI of 1H-Imidazol-5-ylboronic acid?
The InChI of 1H-Imidazol-5-ylboronic acid is InChI=1S/C3H5BN2O2/c7-4(8)3-1-5-2-6-3/h1-2,7-8H,(H,5,6).
What is the InChIKey of 1H-Imidazol-5-ylboronic acid?
The InChIKey of 1H-Imidazol-5-ylboronic acid is GUSNYROLFJGBCT-UHFFFAOYSA-N.
What is the canonical SMILES of 1H-Imidazol-5-ylboronic acid?
The canonical SMILES of 1H-Imidazol-5-ylboronic acid is B(C1=CN=CN1)(O)O.
How many hydrogen bond donor counts are there in 1H-Imidazol-5-ylboronic acid?
There are 3 hydrogen bond donor counts in 1H-Imidazol-5-ylboronic acid.
How many hydrogen bond acceptor counts are there in 1H-Imidazol-5-ylboronic acid?
There are 3 hydrogen bond acceptor counts in 1H-Imidazol-5-ylboronic acid.
How many rotatable bond counts are there in 1H-Imidazol-5-ylboronic acid?
There is 1 rotatable bond count in 1H-Imidazol-5-ylboronic acid.
Recommended Products
CAS
94319-79-6 Purity
---
94319-79-6 Purity
---
