CAS
9431-45-4 Purity
96%
9431-45-4 Purity
96%
Inquiry Basket
3-Pyridinecarbonitrile,5-bromo-6-methoxy-
CAS
943153-51-3
Catalog Number
ACM943153513
Category
Other Products
Molecular Formula
C7H5BrN2O
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C7H5BrN2O.
What is the molecular weight of the compound?
The molecular weight of the compound is 213.03 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-bromo-6-methoxypyridine-3-carbonitrile.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H5BrN2O/c1-11-7-6(8)2-5(3-9)4-10-7/h2,4H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is HVBZVEOIYBWRPE-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is COC1=C(C=C(C=N1)C#N)Br.
What is the CAS number of the compound?
The CAS number of the compound is 943153-51-3.
What is the European Community (EC) Number of the compound?
The European Community (EC) Number of the compound is 858-636-7.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.6.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
