943148-45-6 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H13NO2.
The IUPAC name of the compound is 1-methyl-2-nitro-4-propan-2-ylbenzene.
The InChI of the compound is InChI=1S/C10H13NO2/c1-7(2)9-5-4-8(3)10(6-9)11(12)13/h4-7H,1-3H3.
The InChIKey of the compound is DRKFWQDBPGTSOO-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=C(C=C(C=C1)C(C)C)[N+](=O)[O-].
The CAS number of the compound is 943-15-7.
The molecular weight of the compound is 179.22 g/mol.
The XLogP3-AA value of the compound is 3.2.
The compound does not have any hydrogen bond donor count.
The compound has two hydrogen bond acceptor counts.