94292-00-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C17H16O3S.
The molecular weight of the compound is 300.4 g/mol.
The IUPAC name of the compound is 2-[3-(4-methylsulfanylbenzoyl)phenyl]propanoic acid.
The InChI of the compound is InChI=1S/C17H16O3S/c1-11(17(19)20)13-4-3-5-14(10-13)16(18)12-6-8-15(21-2)9-7-12/h3-11H,1-2H3,(H,19,20).
The InChIKey of the compound is UFDXUEHTMZBRTA-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C1=CC(=CC=C1)C(=O)C2=CC=C(C=C2)SC)C(=O)O.
The CAS number of the compound is 94292-03-2.
The XLogP3 value of the compound is 3.6.
There are 4 hydrogen bond acceptors present in the compound.
Yes, the compound is canonicalized.