942830-53-7 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C10H19N3.
The IUPAC name of the compound is N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]ethanamine.
The InChI of the compound is InChI=1S/C10H19N3/c1-5-11-7-10-8(3)12-13(6-2)9(10)4/h11H,5-7H2,1-4H3.
The InChIKey of the compound is NWFRQPJKLCWABC-UHFFFAOYSA-N.
The molecular weight of the compound is 181.28 g/mol.
The CAS number of the compound is 942852-84-8.
The XLogP3-AA value of the compound is 1.1.
The compound has 1 hydrogen bond donor count.
The compound has 2 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.