94276-04-7 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H18ClNS.
The molecular weight of the compound is 207.76 g/mol.
The IUPAC name of the compound is 3-thia-6-azoniaspiro[5.5]undecane;chloride.
The InChI of the compound is InChI=1S/C9H18NS.ClH/c1-2-4-10(5-3-1)6-8-11-9-7-10;/h1-9H2;1H/q+1;/p-1.
The synonyms of the compound are 3-Thia-6-azoniaspiro(5.5)undecane chloride, 94276-07-0, EINECS 304-496-2, and DTXSID20241357.
The CAS number of the compound is 94276-07-0.
The European Community (EC) number of the compound is 304-496-2.
The hydrogen bond donor count of the compound is 0.
The hydrogen bond acceptor count of the compound is 2.
Yes, the compound is canonicalized.