CAS
942631-53-0 Purity
---
942631-53-0 Purity
---
Inquiry Basket
Naphtho[2,3-b]-1,4-dioxin-6-carboxylic acid,2,3,6,7,8,9-hexahydro-
CAS
942631-77-8
Catalog Number
ACM942631778
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Naphtho[2,3-b]-1,4-dioxin-6-carboxylic acid,2,3,6,7,8,9-hexahydro?
The molecular formula is C13H14O4.
When was the compound first created?
The compound was created on November 19, 2009.
What is the molecular weight of Naphtho[2,3-b]-1,4-dioxin-6-carboxylic acid,2,3,6,7,8,9-hexahydro?
The molecular weight is 234.25 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxine-6-carboxylic acid.
What is the InChI of the compound?
The InChI is InChI=1S/C13H14O4/c14-13(15)9-3-1-2-8-6-11-12(7-10(8)9)17-5-4-16-11/h6-7,9H,1-5H2,(H,14,15).
How many hydrogen bond donor counts are in the compound?
There is 1 hydrogen bond donor count.
What is the hydrogen bond acceptor count of Naphtho[2,3-b]-1,4-dioxin-6-carboxylic acid,2,3,6,7,8,9-hexahydro?
The hydrogen bond acceptor count is 4.
What is the topological polar surface area of the compound?
The topological polar surface area is 55.8 Ų.
How many defined atom stereocenter counts are there in the compound?
There are 0 defined atom stereocenter counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![Naphtho[2,3-b]-1,4-dioxin-7-carboxylic acid,2,3,6,7,8,9-hexahydro-6-oxo-](https://resource.alfa-chemistry.com/structure/942631-75-6.gif)
CAS
942631-75-6 Purity
---
942631-75-6 Purity
---
![[Bis-(trimethylsilyl)amine]dimethylindium](https://resource.alfa-chemistry.com/structure/94265-92-6.gif)
![3-Buten-2-ol,4-bicyclo[2.2.1]hept-5-en-2-yl-3-methyl-](https://resource.alfa-chemistry.com/structure/94265-95-9.gif)
