CAS
942603-46-5 Purity
---
942603-46-5 Purity
---
Inquiry Basket
2-Thiazolecarboxamide,5-amino-N-methyl-
CAS
942631-53-0
Catalog Number
ACM942631530
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula is C5H7N3OS.
What is the molecular weight of the compound?
The molecular weight is 157.20 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-amino-N-methyl-1,3-thiazole-2-carboxamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C5H7N3OS/c1-7-4(9)5-8-2-3(6)10-5/h2H,6H2,1H3,(H,7,9).
What is the InChIKey of the compound?
The InChIKey of the compound is CTLMGUIEBXKOQT-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CNC(=O)C1=NC=C(S1)N.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.2.
How many hydrogen bond donor count does the compound have?
The compound has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does the compound have?
The compound has 4 hydrogen bond acceptor count.
How many rotatable bond count does the compound have?
The compound has 1 rotatable bond count.
Recommended Products
![Naphtho[2,3-b]-1,4-dioxin-7-carboxylic acid,2,3,6,7,8,9-hexahydro-6-oxo-](https://resource.alfa-chemistry.com/structure/942631-75-6.gif)
CAS
942631-75-6 Purity
---
942631-75-6 Purity
---
![Naphtho[2,3-b]-1,4-dioxin-6-carboxylic acid,2,3,6,7,8,9-hexahydro-](https://resource.alfa-chemistry.com/structure/942631-77-8.gif)
CAS
942631-77-8 Purity
---
942631-77-8 Purity
---
