What is the molecular formula of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The molecular formula is C4H9ClN4O2.
What is the molecular weight of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The molecular weight is 180.59 g/mol.
What is the IUPAC name of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The IUPAC name is (2S)-2-amino-4-azidobutanoic acid;hydrochloride.
What is the InChI of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The InChI is InChI=1S/C4H8N4O2.ClH/c5-3(4(9)10)1-2-7-8-6;/h3H,1-2,5H2,(H,9,10);1H/t3-;/m0./s1.
What is the InChIKey of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The InChIKey is MHHYJRIDKLZZEO-DFWYDOINSA-N.
What is the canonical SMILES of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The canonical SMILES is C(CN=[N+]=[N-])C(C(=O)O)N.Cl.
What is the isomeric SMILES of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The isomeric SMILES is C(CN=[N+]=[N-])[C@@H](C(=O)O)N.Cl.
What is the CAS number of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The CAS number is 942518-29-8.
What is the hydrogen bond donor count of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The hydrogen bond donor count is 3.
What is the hydrogen bond acceptor count of 4-Azido-L-homoalanine, (S)-2-amino-4-azidobutanoic acid hydrochloride?
The hydrogen bond acceptor count is 5.