94248-94-9 Purity
96%
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C12H11ClN4O4.
The synonyms of the compound are EINECS 304-374-9, 94248-98-3, N-[6-[2-(5-NITRO-2-FURYL)VINYL]PYRIDAZIN-3-YL]ACETAMIDE MONOHYDROCHLORIDE, and N-(6-(2-(5-Nitro-2-furyl)vinyl)pyridazin-3-yl)acetamide monohydrochloride.
The molecular weight of the compound is 310.69 g/mol.
The IUPAC name of the compound is N-[6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridazin-3-yl]acetamide;hydrochloride.
The InChIKey of the compound is NJCILZCTUYOPQD-VEELZWTKSA-N.
The canonical SMILES of the compound is CC(=O)NC1=NN=C(C=C1)C=CC2=CC=C(O2)[N+](=O)[O-].Cl.
The CAS number of the compound is 94248-98-3.
The European Community (EC) number of the compound is 304-374-9.
The hydrogen bond donor count of the compound is 2.
Yes, the compound is canonicalized.