What is the molecular formula of methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate?
The molecular formula is C18H23NO2.
When was the PubChem CID 3024139 created and last modified?
It was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate?
The IUPAC name is methyl 2-[(1,2,2-trimethylcyclohex-3-en-1-yl)methylideneamino]benzoate.
What is the InChIKey of methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate?
The InChIKey is ZEIURLXALIRALL-UHFFFAOYSA-N.
What is the Canonical SMILES representation of methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate?
The Canonical SMILES representation is CC1(C=CCCC1(C)C=NC2=CC=CC=C2C(=O)OC).
What is the CAS Number of methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate?
The CAS Number is 94248-34-7.
What is the molecular weight of methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate?
The molecular weight is 285.4 g/mol.
How many hydrogen bond acceptors does methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate have?
It has 3 hydrogen bond acceptors.
What is the topological polar surface area of methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate?
The topological polar surface area is 38.7 Ų.
Is methyl 2-[[(trimethyl-3-cyclohexen-1-yl)methylene]amino]benzoate a canonicalized compound?
Yes, it is canonicalized.