94247-97-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C19H24O4.
The molecular weight of the compound is 316.4 g/mol.
The IUPAC name of the compound is 1-ethyl-2-[(2-ethylphenoxy)methoxymethoxymethoxy]benzene.
The InChI of the compound is InChI=1S/C19H24O4/c1-3-16-9-5-7-11-18(16)22-14-20-13-21-15-23-19-12-8-6-10-17(19)4-2/h5-12H,3-4,13-15H2,1-2H3.
The InChIKey of the compound is VTBHDXAWHDYYGW-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCC1=CC=CC=C1OCOCOCOC2=CC=CC=C2CC.
The CAS number of the compound is 94248-02-9.
The EC number of the compound is 304-272-4.
The monoisotopic mass of the compound is 316.16745924 g/mol.
Yes, the compound is canonicalized.