94247-81-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C16H32O2.
The synonyms of the compound are (((Methyldodecyl)oxy)methyl)oxirane, EINECS 304-255-1, and 94247-84-4.
The molecular weight of the compound is 256.42 g/mol.
The IUPAC name of the compound is 2-(tridecan-2-yloxymethyl)oxirane.
The InChI of the compound is InChI=1S/C16H32O2/c1-3-4-5-6-7-8-9-10-11-12-15(2)17-13-16-14-18-16/h15-16H,3-14H2,1-2H3.
The InChIKey of the compound is DMNXKBLMZAAHJP-UHFFFAOYSA-N.
The canonical SMILES of the compound is CCCCCCCCCCCC(C)OCC1CO1.
The CAS number of the compound is 94247-84-4.
The European Community (EC) number of the compound is 304-255-1.
Yes, the compound is canonicalized.