94232-31-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-Amino-4-hydroxybenzenesulfonamide sulfate is C6H10N2O7S2.
The molecular weight of 3-Amino-4-hydroxybenzenesulfonamide sulfate is 286.3 g/mol.
Some synonyms for 3-Amino-4-hydroxybenzenesulfonamide sulfate include 3-Amino-4-hydroxybenzenesulphonamide sulphate and DTXSID90241162.
The IUPAC name of 3-Amino-4-hydroxybenzenesulfonamide sulfate is 3-amino-4-hydroxybenzenesulfonamide;sulfuric acid.
The Canonical SMILES representation of 3-Amino-4-hydroxybenzenesulfonamide sulfate is C1=CC(=C(C=C1S(=O)(=O)N)N)O.OS(=O)(=O)O.
The InChIKey of 3-Amino-4-hydroxybenzenesulfonamide sulfate is FDFVKOFBWUBJRO-UHFFFAOYSA-N.
The CAS number for 3-Amino-4-hydroxybenzenesulfonamide sulfate is 94232-34-5.
There are 5 hydrogen bond donor counts in 3-Amino-4-hydroxybenzenesulfonamide sulfate.
The topological polar surface area of 3-Amino-4-hydroxybenzenesulfonamide sulfate is 198 Ų.
Yes, 3-Amino-4-hydroxybenzenesulfonamide sulfate is considered a canonicalized compound.