942206-35-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C18H19ClFNO3.
The molecular weight is 351.8 g/mol.
2H-Pyrrol-2-one, 4-acetyl-1-(4-chloro-2-fluorophenyl)-5-cyclohexyl-1,5-dihydro-3-hydroxy-, (5S)- and 942222-78-8 (s)-4-acetyl-1-(4-chloro-2-fluorophenyl)-5-cyclohexyl-3-hydroxy-1,5-dihydro-2h-pyrrol-2-one.
(2S)-3-acetyl-1-(4-chloro-2-fluorophenyl)-2-cyclohexyl-4-hydroxy-2H-pyrrol-5-one.
InChI=1S/C18H19ClFNO3/c1-10(22)15-16(11-5-3-2-4-6-11)21(18(24)17(15)23)14-8-7-12(19)9-13(14)20/h7-9,11,16,23H,2-6H2,1H3/t16-/m0/s1.
VQNLJXWZGVRLBA-INIZCTEOSA-N.
The compound has 1 hydrogen bond donor count.
The compound has 3 rotatable bond counts.
The topological polar surface area is 57.6 2.
Yes, the compound is canonicalized.