What is the molecular formula of Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
The molecular formula is C16H8NNaO6.
What is the molecular weight of Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
The molecular weight is 333.23 g/mol.
What are some synonyms for Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
Some synonyms include 94213-68-0, EINECS 303-774-0, Sodium aristolochate-II, and more.
When was Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate created?
It was created on 2007-02-09.
What are the component compounds of Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
The component compounds are CID 108168 (Aristolochic acid II) and CID 5360545 (Sodium).
What is the IUPAC name of Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
The IUPAC name is sodium;6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylate.
What is the Canonical SMILES notation of Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
The Canonical SMILES is C1OC2=C(O1)C3=C(C(=C2)C(=O)[O-])C(=CC4=CC=CC=C43)[N+](=O)[O-].[Na+].
What is the CAS number for Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
The CAS number is 94213-68-0.
How many hydrogen bond acceptor counts are there in Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate?
There are 6 hydrogen bond acceptor counts.
Is Sodium 6-nitrophenanthro[3,4-d]-1,3-dioxole-5-carboxylate a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.