What is the molecular formula of 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide?
The molecular formula is C16H13ClN2O.
When was 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide created and modified in PubChem?
It was created on July 8, 2005, and last modified on December 30, 2023.
What is the IUPAC name of 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide?
The IUPAC name is 2-(chloromethyl)-6-methyl-3-oxido-4-phenylquinazolin-3-ium.
What is the InChI key of 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide?
The InChI key is WFFWEEOVGFHGGZ-UHFFFAOYSA-N.
What is the molecular weight of 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide?
The molecular weight is 284.74 g/mol.
What is the Canonical SMILES representation of 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide?
The Canonical SMILES is CC1=CC2=C(C=C1)N=C([N+](=C2C3=CC=CC=C3)[O-])CCl.
How many hydrogen bond donor counts does 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide have?
It has 0 hydrogen bond donor counts.
What is the Topological Polar Surface Area of 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide?
The Topological Polar Surface Area is 38.4 Ų.
How many rotatable bond counts does 2-(Chloromethyl)-6-methyl-4-phenyl-quinazoline 3-oxide have?
It has 2 rotatable bond counts.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.