CAS
94203-83-5 Purity
96%
94203-83-5 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C11H8BrN3O2.
It was created on March 10, 2008.
The IUPAC name is 5-bromo-N-(2-nitrophenyl)pyridin-2-amine.
The Canonical SMILES is C1=CC=C(C(=C1)NC2=NC=C(C=C2)Br)[N+](=O)[O-].
The molecular weight is 294.10 g/mol.
There is 1 hydrogen bond donor count.
The exact mass is 292.97999 g/mol.
There are 2 rotatable bond counts.
Yes, it is considered canonicalized.
The topological polar surface area is 70.7 Å2.