CAS
94201-70-4 Purity
96%
94201-70-4 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula is C18H29NO3.
The IUPAC Name is methyl 2-[(7-hydroxy-3,7-dimethyloctyl)amino]benzoate.
The molecular weight is 307.4 g/mol.
The Canonical SMILES is CC(CCCC(C)(C)O)CCNC1=CC=CC=C1C(=O)OC.
There are 2 hydrogen bond donor counts.
The XLogP3-AA value is 4.7.
The exact mass is 307.21474379 g/mol.
There are 10 rotatable bond counts.
The topological polar surface area is 58.6 Ų.
Yes, the compound is canonicalized in PubChem.