94201-37-3 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-[[Cyclohexylamino)carbonyl]oxy]ethyl methacrylate is C13H21NO4.
The compound was created on 2005-08-08 and last modified on 2023-12-30.
The IUPAC name of 2-[[Cyclohexylamino)carbonyl]oxy]ethyl methacrylate is 2-(cyclohexylcarbamoyloxy)ethyl 2-methylprop-2-enoate.
The InChI of the compound is InChI=1S/C13H21NO4/c1-10(2)12(15)17-8-9-18-13(16)14-11-6-4-3-5-7-11/h11H,1,3-9H2,2H3,(H,14,16).
The molecular weight of 2-[[Cyclohexylamino)carbonyl]oxy]ethyl methacrylate is 255.31 g/mol.
The compound has 1 hydrogen bond donor count.
The XLogP3-AA value of the compound is 2.6.
The topological polar surface area of the compound is 64.6 2.
The compound has 7 rotatable bond counts.
Yes, the compound is considered canonicalized.