What is the molecular formula of N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
The molecular formula is C8H12N4O3.
When was N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine created?
It was created on August 8, 2005.
What is the IUPAC name of N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
The IUPAC name is N'-(6-methoxy-3-nitropyridin-2-yl)ethane-1,2-diamine.
What is the InChI of N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
The InChI is InChI=1S/C8H12N4O3/c1-15-7-3-2-6(12(13)14)8(11-7)10-5-4-9/h2-3H,4-5,9H2,1H3,(H,10,11).
How many hydrogen bond donor counts are there in N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
There are 2 hydrogen bond donor counts.
What is the topological polar surface area of N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
The topological polar surface area is 106 Ų.
What is the exact mass of N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
The exact mass is 212.09094026 g/mol.
How many heavy atoms are there in N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
There are 15 heavy atoms.
Is N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine a canonicalized compound?
Yes, it is a canonicalized compound.
What is the molecular weight of N-(6-Methoxy-3-nitro-2-pyridyl)ethylenediamine?
The molecular weight is 212.21 g/mol.