94160-28-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C21H36O9.
Some synonyms of the compound are 94160-33-5, EINECS 303-317-5, and DTXSID70916220.
The molecular weight of the compound is 432.5 g/mol.
The compound was created on 2009-08-20 and last modified on 2023-12-30.
The IUPAC name of the compound is 1-[2-(2-hydroxypropoxy)-3-[2-(2-prop-2-enoyloxypropoxy)propoxy]propoxy]propan-2-yl prop-2-enoate.
The InChI of the compound is InChI=1S/C21H36O9/c1-7-20(23)29-17(5)11-26-14-19(28-9-15(3)22)13-25-10-16(4)27-12-18(6)30-21(24)8-2/h7-8,15-19,22H,1-2,9-14H2,3-6H3.
The InChIKey of the compound is PGVXYNCLNDQXPL-UHFFFAOYSA-N.
The Canonical SMILES of the compound is CC(COC(COCC(C)OCC(C)OC(=O)C=C)COCC(C)OC(=O)C=C)O.
The compound has 9 hydrogen bond acceptors.
Yes, the compound is canonicalized.